C17H13N5O2S — CID 43066318
N-(6-methoxy-1,3-benzothiazol-2-yl)-1-phenyltriazole-4-carboxamide (PubChem CID 43066318) has the molecular formula C17H13N5O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-1-phenyltriazole-4-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 43066318 |
| Molecular Formula | C17H13N5O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-1-phenyltriazole-4-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)c3cn(-c4ccccc4)nn3)sc2c1 |
| InChI | InChI=1S/C17H13N5O2S/c1-24-12-7-8-13-15(9-12)25-17(18-13)19-16(23)14-10-22(21-20-14)11-5-3-2-4-6-11/h2-10H,1H3,(H,18,19,23) |
| InChIKey | AITBJDYSEUWAKJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |