C21H16N2O3S — CID 1346004
N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenoxybenzamide (PubChem CID 1346004) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenoxybenzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenoxybenzamide |
|---|---|
| PubChem CID | 1346004 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenoxybenzamide |
| SMILES | COc1ccc2nc(NC(=O)c3ccccc3Oc3ccccc3)sc2c1 |
| InChI | InChI=1S/C21H16N2O3S/c1-25-15-11-12-17-19(13-15)27-21(22-17)23-20(24)16-9-5-6-10-18(16)26-14-7-3-2-4-8-14/h2-13H,1H3,(H,22,23,24) |
| InChIKey | MCBCKMJYRJOSAR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |