About 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide
1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide (PubChem CID 86872730) has the molecular formula C18H15N5O2
and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide |
| PubChem CID | 86872730 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C18H15N5O2/c24-17-15-8-14(7-6-13(15)9-19-17)20-18(25)16-11-23(22-21-16)10-12-4-2-1-3-5-12/h1-8,11H,9-10H2,(H,19,24)(H,20,25) |
| InChIKey | QOPBIOKZFZJBGX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide?
The IUPAC name of 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide (CID 86872730) is 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide.
What is the SMILES notation for 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide?
The canonical SMILES for 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide is O=C(Nc1ccc2c(c1)C(=O)NC2)c1cn(Cc2ccccc2)nn1.
What is the InChIKey of 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide?
The InChIKey is QOPBIOKZFZJBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O2/c24-17-15-8-14(7-6-13(15)9-19-17)20-18(25)16-11-23(22-21-16)10-12-4-2-1-3-5-12/h1-8,11H,9-10H2,(H,19,24)(H,20,25).
What are the key properties of 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide?
1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide has a molecular weight of 333.35 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-(3-oxo-1,2-dihydroisoindol-5-yl)triazole-4-carboxamide is sourced from PubChem (CID 86872730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).