C18H15N5O2 — CID 31867870
1-benzyl-N-[4-(cyanomethoxy)phenyl]triazole-4-carboxamide (PubChem CID 31867870) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-benzyl-N-[4-(cyanomethoxy)phenyl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[4-(cyanomethoxy)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 31867870 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-benzyl-N-[4-(cyanomethoxy)phenyl]triazole-4-carboxamide |
| SMILES | N#CCOc1ccc(NC(=O)c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C18H15N5O2/c19-10-11-25-16-8-6-15(7-9-16)20-18(24)17-13-23(22-21-17)12-14-4-2-1-3-5-14/h1-9,13H,11-12H2,(H,20,24) |
| InChIKey | BEBFYBXMGCZXRD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |