C21H20N6O — CID 166215914
1-benzyl-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]triazole-4-carboxamide (PubChem CID 166215914) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-benzyl-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 166215914 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-benzyl-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]triazole-4-carboxamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)c3cn(Cc4ccccc4)nn3)cc2)c1C |
| InChI | InChI=1S/C21H20N6O/c1-15-16(2)27(14-22-15)19-10-8-18(9-11-19)23-21(28)20-13-26(25-24-20)12-17-6-4-3-5-7-17/h3-11,13-14H,12H2,1-2H3,(H,23,28) |
| InChIKey | RAZOXENUXGDXTQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |