C18H18N4O — CID 18146607
1-benzyl-N-(2,3-dimethylphenyl)triazole-4-carboxamide (PubChem CID 18146607) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-benzyl-N-(2,3-dimethylphenyl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(2,3-dimethylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 18146607 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-benzyl-N-(2,3-dimethylphenyl)triazole-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cn(Cc3ccccc3)nn2)c1C |
| InChI | InChI=1S/C18H18N4O/c1-13-7-6-10-16(14(13)2)19-18(23)17-12-22(21-20-17)11-15-8-4-3-5-9-15/h3-10,12H,11H2,1-2H3,(H,19,23) |
| InChIKey | LOVUPUKPNXZZSN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |