C16H12F2N4O — CID 18152169
1-benzyl-N-(2,4-difluorophenyl)triazole-4-carboxamide (PubChem CID 18152169) has the molecular formula C16H12F2N4O and a molecular weight of 314.30 g/mol. Its IUPAC name is 1-benzyl-N-(2,4-difluorophenyl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(2,4-difluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 18152169 |
| Molecular Formula | C16H12F2N4O |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-benzyl-N-(2,4-difluorophenyl)triazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C16H12F2N4O/c17-12-6-7-14(13(18)8-12)19-16(23)15-10-22(21-20-15)9-11-4-2-1-3-5-11/h1-8,10H,9H2,(H,19,23) |
| InChIKey | NSFVPBMKUQSGII-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |