C19H13F2N5OS — CID 31772694
1-benzyl-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]triazole-4-carboxamide (PubChem CID 31772694) has the molecular formula C19H13F2N5OS and a molecular weight of 397.41 g/mol. Its IUPAC name is 1-benzyl-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 31772694 |
| Molecular Formula | C19H13F2N5OS |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-benzyl-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]triazole-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2cc(F)ccc2F)cs1)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H13F2N5OS/c20-13-6-7-15(21)14(8-13)17-11-28-19(22-17)23-18(27)16-10-26(25-24-16)9-12-4-2-1-3-5-12/h1-8,10-11H,9H2,(H,22,23,27) |
| InChIKey | LQYFXFWNGPSVQM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |