C24H18N4O3 — CID 30873907
3-benzyl-N-[4-(cyanomethoxy)phenyl]-4-oxophthalazine-1-carboxamide (PubChem CID 30873907) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-benzyl-N-[4-(cyanomethoxy)phenyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[4-(cyanomethoxy)phenyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 30873907 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-benzyl-N-[4-(cyanomethoxy)phenyl]-4-oxophthalazine-1-carboxamide |
| SMILES | N#CCOc1ccc(NC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H18N4O3/c25-14-15-31-19-12-10-18(11-13-19)26-23(29)22-20-8-4-5-9-21(20)24(30)28(27-22)16-17-6-2-1-3-7-17/h1-13H,15-16H2,(H,26,29) |
| InChIKey | FWWQVMWOWDLJPG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |