C29H21N5O2 — CID 55375447
N-[4-(benzimidazol-1-yl)phenyl]-3-benzyl-4-oxophthalazine-1-carboxamide (PubChem CID 55375447) has the molecular formula C29H21N5O2 and a molecular weight of 471.52 g/mol. Its IUPAC name is N-[4-(benzimidazol-1-yl)phenyl]-3-benzyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[4-(benzimidazol-1-yl)phenyl]-3-benzyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55375447 |
| Molecular Formula | C29H21N5O2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[4-(benzimidazol-1-yl)phenyl]-3-benzyl-4-oxophthalazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cnc3ccccc32)cc1)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C29H21N5O2/c35-28(31-21-14-16-22(17-15-21)33-19-30-25-12-6-7-13-26(25)33)27-23-10-4-5-11-24(23)29(36)34(32-27)18-20-8-2-1-3-9-20/h1-17,19H,18H2,(H,31,35) |
| InChIKey | GMBNKNCSGAUXHS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |