C27H25N3O3 — CID 38454779
3-benzyl-N-(4-cyclopentyloxyphenyl)-4-oxophthalazine-1-carboxamide (PubChem CID 38454779) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-benzyl-N-(4-cyclopentyloxyphenyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-(4-cyclopentyloxyphenyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 38454779 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-benzyl-N-(4-cyclopentyloxyphenyl)-4-oxophthalazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCCC2)cc1)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C27H25N3O3/c31-26(28-20-14-16-22(17-15-20)33-21-10-4-5-11-21)25-23-12-6-7-13-24(23)27(32)30(29-25)18-19-8-2-1-3-9-19/h1-3,6-9,12-17,21H,4-5,10-11,18H2,(H,28,31) |
| InChIKey | HCEYYKRAYFTIQJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |