C29H27FN4O3 — CID 55722140
3-benzyl-N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-4-oxophthalazine-1-carboxamide (PubChem CID 55722140) has the molecular formula C29H27FN4O3 and a molecular weight of 498.56 g/mol. Its IUPAC name is 3-benzyl-N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55722140 |
| Molecular Formula | C29H27FN4O3 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 3-benzyl-N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-4-oxophthalazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(NC(=O)C2CCCCC2)c1)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C29H27FN4O3/c30-24-16-15-21(17-25(24)32-27(35)20-11-5-2-6-12-20)31-28(36)26-22-13-7-8-14-23(22)29(37)34(33-26)18-19-9-3-1-4-10-19/h1,3-4,7-10,13-17,20H,2,5-6,11-12,18H2,(H,31,36)(H,32,35) |
| InChIKey | MZWHGENHXHVVPE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |