C24H18N4O3 — CID 26683215
3-benzyl-N-(2-methyl-1,3-benzoxazol-5-yl)-4-oxophthalazine-1-carboxamide (PubChem CID 26683215) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-benzyl-N-(2-methyl-1,3-benzoxazol-5-yl)-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-(2-methyl-1,3-benzoxazol-5-yl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 26683215 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-benzyl-N-(2-methyl-1,3-benzoxazol-5-yl)-4-oxophthalazine-1-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)c3nn(Cc4ccccc4)c(=O)c4ccccc34)ccc2o1 |
| InChI | InChI=1S/C24H18N4O3/c1-15-25-20-13-17(11-12-21(20)31-15)26-23(29)22-18-9-5-6-10-19(18)24(30)28(27-22)14-16-7-3-2-4-8-16/h2-13H,14H2,1H3,(H,26,29) |
| InChIKey | QXYYFBBGIYTAOW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |