C20H19N7O — CID 32577417
1-benzyl-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]triazole-4-carboxamide (PubChem CID 32577417) has the molecular formula C20H19N7O and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-benzyl-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 32577417 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-benzyl-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]triazole-4-carboxamide |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)c2cn(Cc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C20H19N7O/c1-2-26-14-21-24-19(26)16-9-6-10-17(11-16)22-20(28)18-13-27(25-23-18)12-15-7-4-3-5-8-15/h3-11,13-14H,2,12H2,1H3,(H,22,28) |
| InChIKey | CYABBPYBPWDODL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |