C14H16N4O3 — CID 122065291
3-[3-(4-ethyl-1,2,4-triazol-3-yl)anilino]-2-methyl-3-oxopropanoic acid (PubChem CID 122065291) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-[3-(4-ethyl-1,2,4-triazol-3-yl)anilino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[3-(4-ethyl-1,2,4-triazol-3-yl)anilino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122065291 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-[3-(4-ethyl-1,2,4-triazol-3-yl)anilino]-2-methyl-3-oxopropanoic acid |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)C(C)C(=O)O)c1 |
| InChI | InChI=1S/C14H16N4O3/c1-3-18-8-15-17-12(18)10-5-4-6-11(7-10)16-13(19)9(2)14(20)21/h4-9H,3H2,1-2H3,(H,16,19)(H,20,21) |
| InChIKey | GGOYQRFNYKDWFD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|