C17H14F2N4O — CID 32581867
N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,4-difluorobenzamide (PubChem CID 32581867) has the molecular formula C17H14F2N4O and a molecular weight of 328.32 g/mol. Its IUPAC name is N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 32581867 |
| Molecular Formula | C17H14F2N4O |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,4-difluorobenzamide |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H14F2N4O/c1-2-23-10-20-22-16(23)11-4-3-5-13(8-11)21-17(24)14-7-6-12(18)9-15(14)19/h3-10H,2H2,1H3,(H,21,24) |
| InChIKey | ILXPTSAXSDTNQK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |