C18H17N5O4 — CID 32574914
N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-methoxy-5-nitrobenzamide (PubChem CID 32574914) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-methoxy-5-nitrobenzamide.
| Compound Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 32574914 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-methoxy-5-nitrobenzamide |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)c2cc([N+](=O)[O-])ccc2OC)c1 |
| InChI | InChI=1S/C18H17N5O4/c1-3-22-11-19-21-17(22)12-5-4-6-13(9-12)20-18(24)15-10-14(23(25)26)7-8-16(15)27-2/h4-11H,3H2,1-2H3,(H,20,24) |
| InChIKey | RAGJFWSUVULVDH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|