C16H18N4O — CID 32581802
(2E,4E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]hexa-2,4-dienamide (PubChem CID 32581802) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is (2E,4E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 32581802 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2E,4E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cccc(-c2nncn2CC)c1 |
| InChI | InChI=1S/C16H18N4O/c1-3-5-6-10-15(21)18-14-9-7-8-13(11-14)16-19-17-12-20(16)4-2/h3,5-12H,4H2,1-2H3,(H,18,21)/b5-3+,10-6+ |
| InChIKey | QWEMZYMJHVVWQK-YBRHCDHNSA-N |
| XLogP | 3.04 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|