C15H23Cl2N5O — CID 119856932
N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119856932) has the molecular formula C15H23Cl2N5O and a molecular weight of 360.29 g/mol. Its IUPAC name is N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119856932 |
| Molecular Formula | C15H23Cl2N5O |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)CCCNC)c1.Cl.Cl |
| InChI | InChI=1S/C15H21N5O.2ClH/c1-3-20-11-17-19-15(20)12-6-4-7-13(10-12)18-14(21)8-5-9-16-2;;/h4,6-7,10-11,16H,3,5,8-9H2,1-2H3,(H,18,21);2*1H |
| InChIKey | LJQPRSOXTYMEGI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|