C19H17FN4O — CID 31916885
(E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 31916885) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is (E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 31916885 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (E)-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)/C=C/c2ccccc2F)c1 |
| InChI | InChI=1S/C19H17FN4O/c1-2-24-13-21-23-19(24)15-7-5-8-16(12-15)22-18(25)11-10-14-6-3-4-9-17(14)20/h3-13H,2H2,1H3,(H,22,25)/b11-10+ |
| InChIKey | BZWFJZAMTQROKA-ZHACJKMWSA-N |
| XLogP | 3.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|