C17H12F4N2O2 — CID 108933370
(E)-3-(2-fluorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide (PubChem CID 108933370) has the molecular formula C17H12F4N2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108933370 |
| Molecular Formula | C17H12F4N2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)Nc1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F4N2O2/c18-14-7-2-1-4-11(14)8-9-15(24)22-12-5-3-6-13(10-12)23-16(25)17(19,20)21/h1-10H,(H,22,24)(H,23,25)/b9-8+ |
| InChIKey | JNSABPDUOMDTEL-CMDGGOBGSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|