C20H20F4N4O2 — CID 86904726
1-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea (PubChem CID 86904726) has the molecular formula C20H20F4N4O2 and a molecular weight of 424.40 g/mol. Its IUPAC name is 1-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea.
| Compound Name | 1-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 86904726 |
| Molecular Formula | C20H20F4N4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
| SMILES | Cc1cccc2nc(CNC(=O)Nc3cccc(COCC(F)(F)C(F)F)c3)cn12 |
| InChI | InChI=1S/C20H20F4N4O2/c1-13-4-2-7-17-26-16(10-28(13)17)9-25-19(29)27-15-6-3-5-14(8-15)11-30-12-20(23,24)18(21)22/h2-8,10,18H,9,11-12H2,1H3,(H2,25,27,29) |
| InChIKey | LWLRUCWKPCXGKN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|