C19H20F4N2O3 — CID 87003591
1-(2-hydroxy-1-phenylethyl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea (PubChem CID 87003591) has the molecular formula C19H20F4N2O3 and a molecular weight of 400.37 g/mol. Its IUPAC name is 1-(2-hydroxy-1-phenylethyl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea.
| Compound Name | 1-(2-hydroxy-1-phenylethyl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 87003591 |
| Molecular Formula | C19H20F4N2O3 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-(2-hydroxy-1-phenylethyl)-3-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(COCC(F)(F)C(F)F)c1)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C19H20F4N2O3/c20-17(21)19(22,23)12-28-11-13-5-4-8-15(9-13)24-18(27)25-16(10-26)14-6-2-1-3-7-14/h1-9,16-17,26H,10-12H2,(H2,24,25,27) |
| InChIKey | GTCDARRTIOFNLH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|