C18H14F4N2O3S — CID 86899332
N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-5-thiophen-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 86899332) has the molecular formula C18H14F4N2O3S and a molecular weight of 414.38 g/mol. Its IUPAC name is N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-5-thiophen-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 86899332 |
| Molecular Formula | C18H14F4N2O3S |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(COCC(F)(F)C(F)F)c1)c1ncoc1-c1cccs1 |
| InChI | InChI=1S/C18H14F4N2O3S/c19-17(20)18(21,22)9-26-8-11-3-1-4-12(7-11)24-16(25)14-15(27-10-23-14)13-5-2-6-28-13/h1-7,10,17H,8-9H2,(H,24,25) |
| InChIKey | YLWDFJVHRHIFEH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|