C20H14N4O3S — CID 75467874
N-(6-benzamido-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 75467874) has the molecular formula C20H14N4O3S and a molecular weight of 390.42 g/mol. Its IUPAC name is N-(6-benzamido-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(6-benzamido-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 75467874 |
| Molecular Formula | C20H14N4O3S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-(6-benzamido-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ncoc2-c2cccs2)cn1)c1ccccc1 |
| InChI | InChI=1S/C20H14N4O3S/c25-19(13-5-2-1-3-6-13)24-16-9-8-14(11-21-16)23-20(26)17-18(27-12-22-17)15-7-4-10-28-15/h1-12H,(H,23,26)(H,21,24,25) |
| InChIKey | VIAOFFIXBKOLDK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |