C22H21N3O3S — CID 7451570
5-thiophen-2-yl-N-[(1R,4R)-1,2,4-trimethyl-3,4-dihydro-1H-[1]benzofuro[3,2-c]pyridin-8-yl]-1,3-oxazole-4-carboxamide (PubChem CID 7451570) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 5-thiophen-2-yl-N-[(1R,4R)-1,2,4-trimethyl-3,4-dihydro-1H-[1]benzofuro[3,2-c]pyridin-8-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-thiophen-2-yl-N-[(1R,4R)-1,2,4-trimethyl-3,4-dihydro-1H-[1]benzofuro[3,2-c]pyridin-8-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 7451570 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 5-thiophen-2-yl-N-[(1R,4R)-1,2,4-trimethyl-3,4-dihydro-1H-[1]benzofuro[3,2-c]pyridin-8-yl]-1,3-oxazole-4-carboxamide |
| SMILES | C[C@@H]1CN(C)[C@H](C)c2c1oc1ccc(NC(=O)c3ncoc3-c3cccs3)cc21 |
| InChI | InChI=1S/C22H21N3O3S/c1-12-10-25(3)13(2)18-15-9-14(6-7-16(15)28-20(12)18)24-22(26)19-21(27-11-23-19)17-5-4-8-29-17/h4-9,11-13H,10H2,1-3H3,(H,24,26)/t12-,13-/m1/s1 |
| InChIKey | NATIKTRDTUWVJS-CHWSQXEVSA-N |
| XLogP | 5.51 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |