C17H16N2O2S — CID 20963618
N-(4-propan-2-ylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 20963618) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-propan-2-ylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 20963618 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)c2ncoc2-c2cccs2)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-11(2)12-5-7-13(8-6-12)19-17(20)15-16(21-10-18-15)14-4-3-9-22-14/h3-11H,1-2H3,(H,19,20) |
| InChIKey | YTKDWCTYZWCOJV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |