C15H11N3O3S — CID 16672225
N-(2-carbamoylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 16672225) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 16672225 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(2-carbamoylphenyl)-5-thiophen-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)c1ncoc1-c1cccs1 |
| InChI | InChI=1S/C15H11N3O3S/c16-14(19)9-4-1-2-5-10(9)18-15(20)12-13(21-8-17-12)11-6-3-7-22-11/h1-8H,(H2,16,19)(H,18,20) |
| InChIKey | XOTGRNWFBKRNDW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |