C16H18N2O2S — CID 95315636
[(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(5-thiophen-2-yl-1,3-oxazol-4-yl)methanone (PubChem CID 95315636) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(5-thiophen-2-yl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(5-thiophen-2-yl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 95315636 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(5-thiophen-2-yl-1,3-oxazol-4-yl)methanone |
| SMILES | O=C(c1ncoc1-c1cccs1)N1CC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H18N2O2S/c19-16(18-8-7-11-4-1-2-5-12(11)18)14-15(20-10-17-14)13-6-3-9-21-13/h3,6,9-12H,1-2,4-5,7-8H2/t11-,12-/m0/s1 |
| InChIKey | BQOIKFAFYOZFIW-RYUDHWBXSA-N |
| XLogP | 3.81 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |