C20H15FN6O2 — CID 75466886
1-(4-fluorophenyl)-N-[3-(pyridin-4-ylmethoxy)-2-pyridinyl]triazole-4-carboxamide (PubChem CID 75466886) has the molecular formula C20H15FN6O2 and a molecular weight of 390.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[3-(pyridin-4-ylmethoxy)-2-pyridinyl]triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[3-(pyridin-4-ylmethoxy)-2-pyridinyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 75466886 |
| Molecular Formula | C20H15FN6O2 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[3-(pyridin-4-ylmethoxy)-2-pyridinyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1ncccc1OCc1ccncc1)c1cn(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C20H15FN6O2/c21-15-3-5-16(6-4-15)27-12-17(25-26-27)20(28)24-19-18(2-1-9-23-19)29-13-14-7-10-22-11-8-14/h1-12H,13H2,(H,23,24,28) |
| InChIKey | LNYKBAWVGSMYSS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |