C16H15FN4O2S — CID 111441794
1-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)triazole-4-carboxamide (PubChem CID 111441794) has the molecular formula C16H15FN4O2S and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 111441794 |
| Molecular Formula | C16H15FN4O2S |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)triazole-4-carboxamide |
| SMILES | CC(O)(CNC(=O)c1cn(-c2ccc(F)cc2)nn1)c1cccs1 |
| InChI | InChI=1S/C16H15FN4O2S/c1-16(23,14-3-2-8-24-14)10-18-15(22)13-9-21(20-19-13)12-6-4-11(17)5-7-12/h2-9,23H,10H2,1H3,(H,18,22) |
| InChIKey | GSYFADGGDUAXQX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |