C15H15FN2O3S — CID 90499889
N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide (PubChem CID 90499889) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide.
| Compound Name | N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide |
|---|---|
| PubChem CID | 90499889 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N'-(4-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide |
| SMILES | CC(O)(CNC(=O)C(=O)Nc1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C15H15FN2O3S/c1-15(21,12-3-2-8-22-12)9-17-13(19)14(20)18-11-6-4-10(16)5-7-11/h2-8,21H,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | YDVVMQOWGKWJNL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|