C14H13F2NO2S — CID 111441795
2,3-difluoro-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide (PubChem CID 111441795) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide.
| Compound Name | 2,3-difluoro-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 111441795 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2,3-difluoro-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide |
| SMILES | CC(O)(CNC(=O)c1cccc(F)c1F)c1cccs1 |
| InChI | InChI=1S/C14H13F2NO2S/c1-14(19,11-6-3-7-20-11)8-17-13(18)9-4-2-5-10(15)12(9)16/h2-7,19H,8H2,1H3,(H,17,18) |
| InChIKey | VRPYLAUQMSMUSJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |