C17H16N2O2S — CID 111442055
N-(2-hydroxy-2-thiophen-2-ylpropyl)quinoline-4-carboxamide (PubChem CID 111442055) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)quinoline-4-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 111442055 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)quinoline-4-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccnc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C17H16N2O2S/c1-17(21,15-7-4-10-22-15)11-19-16(20)13-8-9-18-14-6-3-2-5-12(13)14/h2-10,21H,11H2,1H3,(H,19,20) |
| InChIKey | KEYYEACTXCCXCX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |