C17H21NO5S — CID 90499845
N-(2-hydroxy-2-thiophen-2-ylpropyl)-3,4,5-trimethoxybenzamide (PubChem CID 90499845) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 90499845 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(C)(O)c2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C17H21NO5S/c1-17(20,14-6-5-7-24-14)10-18-16(19)11-8-12(21-2)15(23-4)13(9-11)22-3/h5-9,20H,10H2,1-4H3,(H,18,19) |
| InChIKey | RCPLRFBINQWKSW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |