C12H19NO2S — CID 71782337
N-(2-hydroxy-2-thiophen-2-ylpropyl)-2,2-dimethylpropanamide (PubChem CID 71782337) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)-2,2-dimethylpropanamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71782337 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C12H19NO2S/c1-11(2,3)10(14)13-8-12(4,15)9-6-5-7-16-9/h5-7,15H,8H2,1-4H3,(H,13,14) |
| InChIKey | RUUAKJAZMWDFOH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |