C13H22N2O2S — CID 111441786
2-(diethylamino)-N-(2-hydroxy-2-thiophen-2-ylpropyl)acetamide (PubChem CID 111441786) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2-hydroxy-2-thiophen-2-ylpropyl)acetamide.
| Compound Name | 2-(diethylamino)-N-(2-hydroxy-2-thiophen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 111441786 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(diethylamino)-N-(2-hydroxy-2-thiophen-2-ylpropyl)acetamide |
| SMILES | CCN(CC)CC(=O)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C13H22N2O2S/c1-4-15(5-2)9-12(16)14-10-13(3,17)11-7-6-8-18-11/h6-8,17H,4-5,9-10H2,1-3H3,(H,14,16) |
| InChIKey | MFEZKVSTYSLJLJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |