C12H19NO2S — CID 90499744
N-(2-hydroxy-2-thiophen-2-ylpropyl)pentanamide (PubChem CID 90499744) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)pentanamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)pentanamide |
|---|---|
| PubChem CID | 90499744 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)pentanamide |
| SMILES | CCCCC(=O)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C12H19NO2S/c1-3-4-7-11(14)13-9-12(2,15)10-6-5-8-16-10/h5-6,8,15H,3-4,7,9H2,1-2H3,(H,13,14) |
| InChIKey | HVUNXFFADXUIFS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |