C11H19NO3S2 — CID 71782464
N-(2-hydroxy-2-thiophen-2-ylpropyl)butane-1-sulfonamide (PubChem CID 71782464) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)butane-1-sulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 71782464 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C11H19NO3S2/c1-3-4-8-17(14,15)12-9-11(2,13)10-6-5-7-16-10/h5-7,12-13H,3-4,8-9H2,1-2H3 |
| InChIKey | RHMWWLVQAIBYCO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |