C14H16ClNO4S2 — CID 95983496
3-chloro-N-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-4-methoxybenzenesulfonamide (PubChem CID 95983496) has the molecular formula C14H16ClNO4S2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-chloro-N-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 95983496 |
| Molecular Formula | C14H16ClNO4S2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-chloro-N-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC[C@](C)(O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C14H16ClNO4S2/c1-14(17,13-4-3-7-21-13)9-16-22(18,19)10-5-6-12(20-2)11(15)8-10/h3-8,16-17H,9H2,1-2H3/t14-/m0/s1 |
| InChIKey | QAWDYISJKWSDKG-AWEZNQCLSA-N |
| XLogP | 2.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |