C11H14ClNO6S — CID 66174031
3-[(3-chloro-4-methoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66174031) has the molecular formula C11H14ClNO6S and a molecular weight of 323.75 g/mol. Its IUPAC name is 3-[(3-chloro-4-methoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(3-chloro-4-methoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66174031 |
| Molecular Formula | C11H14ClNO6S |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 3-[(3-chloro-4-methoxyphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | COc1ccc(S(=O)(=O)NCC(C)(O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H14ClNO6S/c1-11(16,10(14)15)6-13-20(17,18)7-3-4-9(19-2)8(12)5-7/h3-5,13,16H,6H2,1-2H3,(H,14,15) |
| InChIKey | BSQKMJBKMUPSHK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |