C16H18ClNO4S2 — CID 71781761
5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methoxybenzenesulfonamide (PubChem CID 71781761) has the molecular formula C16H18ClNO4S2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 71781761 |
| Molecular Formula | C16H18ClNO4S2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCC(O)(c1cccs1)C1CC1 |
| InChI | InChI=1S/C16H18ClNO4S2/c1-22-13-7-6-12(17)9-14(13)24(20,21)18-10-16(19,11-4-5-11)15-3-2-8-23-15/h2-3,6-9,11,18-19H,4-5,10H2,1H3 |
| InChIKey | MBZJBCGIPRTLAH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |