C18H23NO4S2 — CID 90497139
N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-4-propoxybenzenesulfonamide (PubChem CID 90497139) has the molecular formula C18H23NO4S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-4-propoxybenzenesulfonamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90497139 |
| Molecular Formula | C18H23NO4S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NCC(O)(c2cccs2)C2CC2)cc1 |
| InChI | InChI=1S/C18H23NO4S2/c1-2-11-23-15-7-9-16(10-8-15)25(21,22)19-13-18(20,14-5-6-14)17-4-3-12-24-17/h3-4,7-10,12,14,19-20H,2,5-6,11,13H2,1H3 |
| InChIKey | IOLKOVDFPOKEIQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |