C16H18ClNO3S2 — CID 90497128
5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methylbenzenesulfonamide (PubChem CID 90497128) has the molecular formula C16H18ClNO3S2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90497128 |
| Molecular Formula | C16H18ClNO3S2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 5-chloro-N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)NCC(O)(c1cccs1)C1CC1 |
| InChI | InChI=1S/C16H18ClNO3S2/c1-11-4-7-13(17)9-14(11)23(20,21)18-10-16(19,12-5-6-12)15-3-2-8-22-15/h2-4,7-9,12,18-19H,5-6,10H2,1H3 |
| InChIKey | LVXXMHHPFNRMAM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |