C15H19NO2S2 — CID 79477673
2-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)benzenesulfonamide (PubChem CID 79477673) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)benzenesulfonamide.
| Compound Name | 2-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79477673 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)benzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C15H19NO2S2/c1-12-7-4-5-8-13(12)20(17,18)16-11-15(2,3)14-9-6-10-19-14/h4-10,16H,11H2,1-3H3 |
| InChIKey | PVJFGEVAKHXCGD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |