C13H18N2O2S3 — CID 106072628
2-(aminomethyl)-N-(2-methyl-2-thiophen-2-ylpropyl)thiophene-3-sulfonamide (PubChem CID 106072628) has the molecular formula C13H18N2O2S3 and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-methyl-2-thiophen-2-ylpropyl)thiophene-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(2-methyl-2-thiophen-2-ylpropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106072628 |
| Molecular Formula | C13H18N2O2S3 |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(aminomethyl)-N-(2-methyl-2-thiophen-2-ylpropyl)thiophene-3-sulfonamide |
| SMILES | CC(C)(CNS(=O)(=O)c1ccsc1CN)c1cccs1 |
| InChI | InChI=1S/C13H18N2O2S3/c1-13(2,12-4-3-6-19-12)9-15-20(16,17)11-5-7-18-10(11)8-14/h3-7,15H,8-9,14H2,1-2H3 |
| InChIKey | SXPWWHDGMKHHDH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |