C12H18BrNO2S — CID 115365244
N-(3-bromo-2,2-dimethylpropyl)-2-methylbenzenesulfonamide (PubChem CID 115365244) has the molecular formula C12H18BrNO2S and a molecular weight of 320.25 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)-2-methylbenzenesulfonamide.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115365244 |
| Molecular Formula | C12H18BrNO2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NCC(C)(C)CBr |
| InChI | InChI=1S/C12H18BrNO2S/c1-10-6-4-5-7-11(10)17(15,16)14-9-12(2,3)8-13/h4-7,14H,8-9H2,1-3H3 |
| InChIKey | LUIGUABCGGEOJN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|