C15H18BrNO2S — CID 114795680
N-(3-bromo-2,2-dimethylpropyl)naphthalene-1-sulfonamide (PubChem CID 114795680) has the molecular formula C15H18BrNO2S and a molecular weight of 356.29 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)naphthalene-1-sulfonamide.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 114795680 |
| Molecular Formula | C15H18BrNO2S |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)naphthalene-1-sulfonamide |
| SMILES | CC(C)(CBr)CNS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H18BrNO2S/c1-15(2,10-16)11-17-20(18,19)14-9-5-7-12-6-3-4-8-13(12)14/h3-9,17H,10-11H2,1-2H3 |
| InChIKey | XUUVMEWIRGCHIA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|