C14H18N2O3S — CID 115363092
N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-5-sulfonamide (PubChem CID 115363092) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-5-sulfonamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 115363092 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)isoquinoline-5-sulfonamide |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C14H18N2O3S/c1-14(2,10-17)9-16-20(18,19)13-5-3-4-11-8-15-7-6-12(11)13/h3-8,16-17H,9-10H2,1-2H3 |
| InChIKey | USRDLOIJRZMPBA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |