C16H22N2O3S — CID 84599044
N-(4-hydroxy-2,2-dimethylpentyl)isoquinoline-5-sulfonamide (PubChem CID 84599044) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)isoquinoline-5-sulfonamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 84599044 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)isoquinoline-5-sulfonamide |
| SMILES | CC(O)CC(C)(C)CNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C16H22N2O3S/c1-12(19)9-16(2,3)11-18-22(20,21)15-6-4-5-13-10-17-8-7-14(13)15/h4-8,10,12,18-19H,9,11H2,1-3H3 |
| InChIKey | RCVDELIXPJDSHG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |